CAS 1172338-38-3 appears in our catalog under these names: [3-(4-CHLOROPHENYL)PHENYL]METHYLAMINEHCL, 97%, [3-(4-Chlorophenyl)phenyl]methylamine hydrochloride, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 250mg.
[3-(4-chlorophenyl)phenyl]methanamine;hydrochloride (CAS 1172338-38-3) is a chemical compound with the molecular formula C13H13Cl2N and a molecular weight of 254.15 g/mol. IUPAC name: [3-(4-chlorophenyl)phenyl]methanamine;hydrochloride. InChIKey: CSGLTGDPVNOESA-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2N |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | [3-(4-chlorophenyl)phenyl]methanamine;hydrochloride |
| InChIKey | CSGLTGDPVNOESA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=C(C=C2)Cl)CN.Cl |
Computed by PubChem (NCBI)