CAS 162732-99-2 is the registry number for 1-(3,4-Dichlorophenyl)cyclohexanecarbonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(3,4-dichlorophenyl)cyclohexane-1-carbonitrile (CAS 162732-99-2) is a chemical compound with the molecular formula C13H13Cl2N and a molecular weight of 254.15 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)cyclohexane-1-carbonitrile. InChIKey: QUQZVJXAKWBZEU-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2N |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)cyclohexane-1-carbonitrile |
| InChIKey | QUQZVJXAKWBZEU-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C#N)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)