Products 1037130-92-9
CAS 1037130-92-9 is the registry number for 1-(2,4-Dichlorophenyl)cyclohexane-1-carbonitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(2,4-dichlorophenyl)cyclohexane-1-carbonitrile (CAS 1037130-92-9) is a chemical compound with the molecular formula C13H13Cl2N and a molecular weight of 254.15 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)cyclohexane-1-carbonitrile. InChIKey: QJUDXIZBRXRXCQ-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2N |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)cyclohexane-1-carbonitrile |
| InChIKey | QJUDXIZBRXRXCQ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C#N)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)