Products 93445-15-9
CAS 93445-15-9 appears in our catalog under these names: N-benzyl-3-chloroaniline hydrochloride, 95%, N-Benzyl-3-chloroaniline hydrochloride, 98%, N-Benzyl-3-chloroaniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
N-benzyl-3-chloroaniline;hydrochloride (CAS 93445-15-9) is a chemical compound with the molecular formula C13H13Cl2N and a molecular weight of 254.15 g/mol. IUPAC name: N-benzyl-3-chloroaniline;hydrochloride. InChIKey: KTEGESCSRYVFGA-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2N |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | N-benzyl-3-chloroaniline;hydrochloride |
| InChIKey | KTEGESCSRYVFGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)