CAS 451503-29-0 appears in our catalog under these names: (R)-(4-Chlorophenyl)(phenyl)methanamine hydrochloride, 95%, (R)–(4–Chlorophenyl)(phenyl)methanamine hydrochloride, (R)-(4-Chlorophenyl)(phenyl)methanamine hydrochloride 95%, (R)-(4-Chlorophenyl)(phenyl)methanamine HCl, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
(R)-(4-chlorophenyl)-phenylmethanamine;hydrochloride (CAS 451503-29-0) is a chemical compound with the molecular formula C13H13Cl2N and a molecular weight of 254.15 g/mol. IUPAC name: (R)-(4-chlorophenyl)-phenylmethanamine;hydrochloride. InChIKey: UHPRBUXOILBKFH-BTQNPOSSSA-N.
| Molecular formula | C13H13Cl2N |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | (R)-(4-chlorophenyl)-phenylmethanamine;hydrochloride |
| InChIKey | UHPRBUXOILBKFH-BTQNPOSSSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C2=CC=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)