CAS 518357-42-1 appears in our catalog under these names: [4-(2-Chlorophenyl)phenyl]methylamine hydrochloride, 95%, (2'-Chloro-(1,1'-biphenyl)-4-yl)methanamine hydrochloride, 95%, (2'-Chloro-[1,1'-biphenyl]-4-yl)methanamine hydrochloride, 97%, 97%, 4-(2-CHLOROPHENYL)BENZYLAMINE HCL, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10mg, 25mg, 100mg, 250mg.
[4-(2-chlorophenyl)phenyl]methanamine;hydrochloride (CAS 518357-42-1) is a chemical compound with the molecular formula C13H13Cl2N and a molecular weight of 254.15 g/mol. IUPAC name: [4-(2-chlorophenyl)phenyl]methanamine;hydrochloride. InChIKey: URGRCECNVGEABW-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2N |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | [4-(2-chlorophenyl)phenyl]methanamine;hydrochloride |
| InChIKey | URGRCECNVGEABW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)CN)Cl.Cl |
Computed by PubChem (NCBI)