CAS 5267-39-0 appears in our catalog under these names: 2-Chlorobenzhydryl amine, (4-Chlorophenyl)(phenyl)methanamine, (4-Chlorophenyl)(phenyl)methanamine hydrochloride 97%, 4-Chlorobenzhydrylamine, HCl, 97%, 97%, (4-Chlorophenyl)(phenyl)methanamine hydrochloride, 97%. Offered by: Chemat Brand, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 10g, 250mg, 1g, 5g.
(4-chlorophenyl)-phenylmethanamine;hydrochloride (CAS 5267-39-0) is a chemical compound with the molecular formula C13H13Cl2N and a molecular weight of 254.15 g/mol. IUPAC name: (4-chlorophenyl)-phenylmethanamine;hydrochloride. InChIKey: UHPRBUXOILBKFH-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2N |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | (4-chlorophenyl)-phenylmethanamine;hydrochloride |
| InChIKey | UHPRBUXOILBKFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)