(2,3-Difluoro-4-(hydroxymethyl)phenyl)boronic acid, 98+%
cas: 1315281-32-3 — see every product listed under this CAS number, including other names
(2,3-Difluoro-4-(hydroxymethyl)phenyl)boronic acid, 98+% (CAS 1315281-32-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A794473-25g |
| cas | 1315281-32-3 |
| size | 25g |
| availability | Synthetic Items: 0g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 13864.69 Pln | |
| AmBeed | 250mg | 642.88 Pln |
properties
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2,3-difluoro-4-(hydroxymethyl)phenyl]boronic acid (CAS 1315281-32-3) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: [2,3-difluoro-4-(hydroxymethyl)phenyl]boronic acid. InChIKey: DISWKAIUDZCVHF-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | [2,3-difluoro-4-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | DISWKAIUDZCVHF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)CO)F)F)(O)O |
Computed by PubChem (NCBI)