Products 1315281-32-3
CAS 1315281-32-3 appears in our catalog under these names: 2,3-Difluoro-4-(hydroxymethyl)phenylboronic acid, 95%, (2,3-Difluoro-4-(hydroxymethyl)phenyl)boronic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 250mg.
[2,3-difluoro-4-(hydroxymethyl)phenyl]boronic acid (CAS 1315281-32-3) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: [2,3-difluoro-4-(hydroxymethyl)phenyl]boronic acid. InChIKey: DISWKAIUDZCVHF-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | [2,3-difluoro-4-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | DISWKAIUDZCVHF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)CO)F)F)(O)O |
Computed by PubChem (NCBI)