(2,4-Difluoro-3-methoxyphenyl)boronic acid 98%
cas: 406482-18-6 — see every product listed under this CAS number, including other names
(2,4-Difluoro-3-methoxyphenyl)boronic acid 98% (CAS 406482-18-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A665261-100mg |
| cas | 406482-18-6 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1766.56 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A665261 |
(2,4-difluoro-3-methoxyphenyl)boronic acid (CAS 406482-18-6) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (2,4-difluoro-3-methoxyphenyl)boronic acid. InChIKey: NRIQRAMCXSJILE-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (2,4-difluoro-3-methoxyphenyl)boronic acid |
| InChIKey | NRIQRAMCXSJILE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)OC)F)(O)O |
Computed by PubChem (NCBI)