(2,6-Dichloro-4-methoxyphenyl)boronic acid, 98%, 98%
cas: 851756-60-0 — see every product listed under this CAS number, including other names
(2,6-Dichloro-4-methoxyphenyl)boronic acid, 98%, 98% (CAS 851756-60-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120CPN-100mg |
| cas | 851756-60-0 |
| size | 100mg |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 467.60 Pln | |
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 1g | 1946.00 Pln | |
| Chemat | 5g | 5901.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,6-dichloro-4-methoxyphenyl)boronic acid (CAS 851756-60-0) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (2,6-dichloro-4-methoxyphenyl)boronic acid. InChIKey: ZTLVJCQYCNMWQO-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (2,6-dichloro-4-methoxyphenyl)boronic acid |
| InChIKey | ZTLVJCQYCNMWQO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Cl)OC)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2,6-dichloro-4-methoxyphenyl)boronic acid, (2,6-Dichloro-4-methoxy-phenyl)boronic acid, Boronic acid, (2,6-dichloro-4-methoxyphenyl)-, 2,6-Dichloro-4-methoxyphenylboronic acid, B-(2,6-Dichloro-4-methoxyphenyl)boronic acid, Boronic acid, B-(2,6-dichloro-4-methoxyphenyl)-, (2,6-Dichloro-4-methoxyphenyl)boronic acid - [D88747]