Products 1190219-72-7
CAS 1190219-72-7 appears in our catalog under these names: 2,3-Dichloro-4-methoxyphenylboronic acid, 98%, (2,3-Dichloro-4-methoxyphenyl)boronic acid 98%, 2,3-Dichloro-4-methoxyphenylboronic acid, 98%, 98%, (2,3-Dichloro-4-methoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(2,3-dichloro-4-methoxyphenyl)boronic acid (CAS 1190219-72-7) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (2,3-dichloro-4-methoxyphenyl)boronic acid. InChIKey: FBELHXIPMFECAK-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (2,3-dichloro-4-methoxyphenyl)boronic acid |
| InChIKey | FBELHXIPMFECAK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OC)Cl)Cl)(O)O |
Computed by PubChem (NCBI)