Products 2573074-25-4

CAS 2573074-25-4 appears in our catalog under these names: 3,5-Dichloro-2-methoxyphenylboronic acid, 95%, (3,5-Dichloro-2-methoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

(3,5-dichloro-2-methoxyphenyl)boronic acid (CAS 2573074-25-4) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (3,5-dichloro-2-methoxyphenyl)boronic acid. InChIKey: MJRIIYDEDWEQSN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BCl2O3
Molecular weight220.84 g/mol
IUPAC name(3,5-dichloro-2-methoxyphenyl)boronic acid
InChIKeyMJRIIYDEDWEQSN-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1OC)Cl)Cl)(O)O

Computed by PubChem (NCBI)