CAS 2573074-25-4 appears in our catalog under these names: 3,5-Dichloro-2-methoxyphenylboronic acid, 95%, (3,5-Dichloro-2-methoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g.
(3,5-dichloro-2-methoxyphenyl)boronic acid (CAS 2573074-25-4) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (3,5-dichloro-2-methoxyphenyl)boronic acid. InChIKey: MJRIIYDEDWEQSN-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (3,5-dichloro-2-methoxyphenyl)boronic acid |
| InChIKey | MJRIIYDEDWEQSN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC)Cl)Cl)(O)O |
Computed by PubChem (NCBI)