Products 851756-60-0
CAS 851756-60-0 appears in our catalog under these names: (2,6-Dichloro-4-methoxyphenyl)boronic acid, 96%, (2,6-Dichloro-4-methoxyphenyl)boronic acid, 98%, 98%, (2,6-DICHLORO-4-METHOXYPHENYL)BORONIC ACID, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
(2,6-dichloro-4-methoxyphenyl)boronic acid (CAS 851756-60-0) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (2,6-dichloro-4-methoxyphenyl)boronic acid. InChIKey: ZTLVJCQYCNMWQO-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (2,6-dichloro-4-methoxyphenyl)boronic acid |
| InChIKey | ZTLVJCQYCNMWQO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Cl)OC)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2,6-dichloro-4-methoxyphenyl)boronic acid, (2,6-Dichloro-4-methoxy-phenyl)boronic acid, Boronic acid, (2,6-dichloro-4-methoxyphenyl)-, 2,6-Dichloro-4-methoxyphenylboronic acid, B-(2,6-Dichloro-4-methoxyphenyl)boronic acid, Boronic acid, B-(2,6-dichloro-4-methoxyphenyl)-, (2,6-Dichloro-4-methoxyphenyl)boronic acid - [D88747]