Products 175883-61-1
CAS 175883-61-1 appears in our catalog under these names: 3,5-Dichloro-4-methoxyphenylboronic acid, 98%, (3,5-Dichloro-4-methoxyphenyl)boronic acid 98%, (3,5-Dichloro-4-methoxyphenyl),boronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg, 25g.
(3,5-dichloro-4-methoxyphenyl)boronic acid (CAS 175883-61-1) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (3,5-dichloro-4-methoxyphenyl)boronic acid. InChIKey: JHCLSOGJYUVJNQ-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (3,5-dichloro-4-methoxyphenyl)boronic acid |
| InChIKey | JHCLSOGJYUVJNQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OC)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3,5-Dichloro-4-methoxyphenylboronic acid, (3,5-dichloro-4-methoxyphenyl)boronic acid, 3,5-Dichloro-4-methoxybenzeneboronic acid, (3,5-Dichloro-4-methoxyphenyl);boronic acid, (3,5-dichloro-4-methoxy-phenyl)boronic Acid, (3,5-dichloro-4-methoxyphenyl)boronicacid, 3,5-dichloro-4-methoxybenzeneboronic acid, AldrichCPR