CAS 1256354-93-4 appears in our catalog under these names: 4,5-Dichloro-2-methoxyphenylboronic acid, 97%, (4,5-Dichloro-2-methoxyphenyl)boronic acid 97%, 4,5-Dichloro-2-methoxyphenylboronic acid, ≥95%, ≥95%, 4,5-Dichloro-2-methoxyphenylboronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
(4,5-dichloro-2-methoxyphenyl)boronic acid (CAS 1256354-93-4) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (4,5-dichloro-2-methoxyphenyl)boronic acid. InChIKey: FLEKBCZAZMHPLQ-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (4,5-dichloro-2-methoxyphenyl)boronic acid |
| InChIKey | FLEKBCZAZMHPLQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC)Cl)Cl)(O)O |
Computed by PubChem (NCBI)