Products 944128-90-9
CAS 944128-90-9 appears in our catalog under these names: 2,4-Dichloro-3-methoxyphenylboronic acid, 98%, (2,4-Dichloro-3-methoxyphenyl)boronic acid, 98%, 2,4-Dichloro-3-methoxyphenylboronic acid, ≥95%, ≥95%, (2,4-Dichloro-3-methoxyphenyl)boronic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g.
(2,4-dichloro-3-methoxyphenyl)boronic acid (CAS 944128-90-9) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (2,4-dichloro-3-methoxyphenyl)boronic acid. InChIKey: MXEDURITVCMIOA-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (2,4-dichloro-3-methoxyphenyl)boronic acid |
| InChIKey | MXEDURITVCMIOA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)OC)Cl)(O)O |
Computed by PubChem (NCBI)