Products 2121514-53-0
CAS 2121514-53-0 is the registry number for 2,6-Dichloro-4-(hydroxymethyl)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
[2,6-dichloro-4-(hydroxymethyl)phenyl]boronic acid (CAS 2121514-53-0) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: [2,6-dichloro-4-(hydroxymethyl)phenyl]boronic acid. InChIKey: NZDFOFXGUWPQFO-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | [2,6-dichloro-4-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | NZDFOFXGUWPQFO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Cl)CO)Cl)(O)O |
Computed by PubChem (NCBI)