Products 2121514-53-0

CAS 2121514-53-0 appears in our catalog under these names: 2,6-Dichloro-4-(hydroxymethyl)phenylboronic acid, 95%, 2,6-Dichloro-4-(hydroxymethyl)phenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg.

Structural formula: {0} (CAS {1})

[2,6-dichloro-4-(hydroxymethyl)phenyl]boronic acid (CAS 2121514-53-0) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: [2,6-dichloro-4-(hydroxymethyl)phenyl]boronic acid. InChIKey: NZDFOFXGUWPQFO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BCl2O3
Molecular weight220.84 g/mol
IUPAC name[2,6-dichloro-4-(hydroxymethyl)phenyl]boronic acid
InChIKeyNZDFOFXGUWPQFO-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1Cl)CO)Cl)(O)O

Computed by PubChem (NCBI)