CAS 2096329-64-3 appears in our catalog under these names: 3,4-Dichloro-2-methoxyphenylboronic acid, 95%, (3,4-Dichloro-2-methoxyphenyl)boronic acid, 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 10g, 1g, 250mg.
(3,4-dichloro-2-methoxyphenyl)boronic acid (CAS 2096329-64-3) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (3,4-dichloro-2-methoxyphenyl)boronic acid. InChIKey: HQUBCRULYJNVOU-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (3,4-dichloro-2-methoxyphenyl)boronic acid |
| InChIKey | HQUBCRULYJNVOU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)Cl)OC)(O)O |
Computed by PubChem (NCBI)