cas: 1451393-60-4 — see every product listed under this CAS number, including other names
(2,6-Difluoro-4-(hydroxymethyl)phenyl)boronic acid, 97% (CAS 1451393-60-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A263675-10g |
| cas | 1451393-60-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17334.52 Pln | |
| AmBeed | 25g | 34006.63 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2,6-difluoro-4-(hydroxymethyl)phenyl]boronic acid (CAS 1451393-60-4) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: [2,6-difluoro-4-(hydroxymethyl)phenyl]boronic acid. InChIKey: MJXZDKYAMFZLML-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | [2,6-difluoro-4-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | MJXZDKYAMFZLML-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)CO)F)(O)O |
Computed by PubChem (NCBI)