cas: 1135021-79-2 — see every product listed under this CAS number, including other names
(2-Chloro-5-nitrophenyl)methanamine hydrochloride, 97% (CAS 1135021-79-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F649470-50MG |
| cas | 1135021-79-2 |
| size | 50mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 529.00 Pln | |
| Fluorochem | 100mg | 685.19 Pln | |
| Fluorochem | 250mg | 955.93 Pln | |
| Fluorochem | 500mg | 1674.43 Pln | |
| Fluorochem | 1g | 2325.24 Pln | |
| Fluorochem | 2.5g | 4673.37 Pln | |
| Chemat | 100mg | 530.00 Pln | |
| Chemat | 250mg | 731.60 Pln | |
| Chemat | 1g | 1773.20 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2-chloro-5-nitrophenyl)methanamine;hydrochloride (CAS 1135021-79-2) is a chemical compound with the molecular formula C7H8Cl2N2O2 and a molecular weight of 223.05 g/mol. IUPAC name: (2-chloro-5-nitrophenyl)methanamine;hydrochloride. InChIKey: GXCLYHPWCNWNFX-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl2N2O2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | (2-chloro-5-nitrophenyl)methanamine;hydrochloride |
| InChIKey | GXCLYHPWCNWNFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CN)Cl.Cl |
Computed by PubChem (NCBI)