CAS 1803612-15-8 is the registry number for Methyl 5-amino-3-chloropyridine-2-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 5-amino-3-chloropyridine-2-carboxylate;hydrochloride (CAS 1803612-15-8) is a chemical compound with the molecular formula C7H8Cl2N2O2 and a molecular weight of 223.05 g/mol. IUPAC name: methyl 5-amino-3-chloropyridine-2-carboxylate;hydrochloride. InChIKey: JNAVNTLIVGRCLM-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl2N2O2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | methyl 5-amino-3-chloropyridine-2-carboxylate;hydrochloride |
| InChIKey | JNAVNTLIVGRCLM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=N1)N)Cl.Cl |
Computed by PubChem (NCBI)