Products 1803612-15-8

CAS 1803612-15-8 is the registry number for Methyl 5-amino-3-chloropyridine-2-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 5-amino-3-chloropyridine-2-carboxylate;hydrochloride (CAS 1803612-15-8) is a chemical compound with the molecular formula C7H8Cl2N2O2 and a molecular weight of 223.05 g/mol. IUPAC name: methyl 5-amino-3-chloropyridine-2-carboxylate;hydrochloride. InChIKey: JNAVNTLIVGRCLM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8Cl2N2O2
Molecular weight223.05 g/mol
IUPAC namemethyl 5-amino-3-chloropyridine-2-carboxylate;hydrochloride
InChIKeyJNAVNTLIVGRCLM-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=N1)N)Cl.Cl

Computed by PubChem (NCBI)