Products 1135056-86-8
CAS 1135056-86-8 appears in our catalog under these names: (2-Chloro-4-nitrophenyl)methanamine hydrochloride, 97%, (2-Chloro-4-nitrophenyl)methanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2-chloro-4-nitrophenyl)methanamine;hydrochloride (CAS 1135056-86-8) is a chemical compound with the molecular formula C7H8Cl2N2O2 and a molecular weight of 223.05 g/mol. IUPAC name: (2-chloro-4-nitrophenyl)methanamine;hydrochloride. InChIKey: MTKJAEKTVXZPER-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl2N2O2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | (2-chloro-4-nitrophenyl)methanamine;hydrochloride |
| InChIKey | MTKJAEKTVXZPER-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)CN.Cl |
Computed by PubChem (NCBI)