CAS 1135021-79-2 appears in our catalog under these names: (2-Chloro-5-nitrophenyl)methanamine hydrochloride, (2-Chloro-5-nitrophenyl)methanamine hydrochloride, 95%, (2-Chloro-5-nitrophenyl)methanamine hydrochloride, 97%, (2-Chloro-5-nitrophenyl)methanamine hydrochloride, 97%, 97%. Offered by: Biosynth, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 5g, 10g, 50mg, 250mg, 500mg, 2.5g.
(2-chloro-5-nitrophenyl)methanamine;hydrochloride (CAS 1135021-79-2) is a chemical compound with the molecular formula C7H8Cl2N2O2 and a molecular weight of 223.05 g/mol. IUPAC name: (2-chloro-5-nitrophenyl)methanamine;hydrochloride. InChIKey: GXCLYHPWCNWNFX-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl2N2O2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | (2-chloro-5-nitrophenyl)methanamine;hydrochloride |
| InChIKey | GXCLYHPWCNWNFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CN)Cl.Cl |
Computed by PubChem (NCBI)