Products 184163-49-3

CAS 184163-49-3 is the registry number for 2-Chloro-5-hydrazinylbenzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

2-chloro-5-hydrazinylbenzoic acid;hydrochloride (CAS 184163-49-3) is a chemical compound with the molecular formula C7H8Cl2N2O2 and a molecular weight of 223.05 g/mol. IUPAC name: 2-chloro-5-hydrazinylbenzoic acid;hydrochloride. InChIKey: LYSZNCNDYFXUJI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8Cl2N2O2
Molecular weight223.05 g/mol
IUPAC name2-chloro-5-hydrazinylbenzoic acid;hydrochloride
InChIKeyLYSZNCNDYFXUJI-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1NN)C(=O)O)Cl.Cl

Computed by PubChem (NCBI)