CAS 184163-49-3 is the registry number for 2-Chloro-5-hydrazinylbenzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-chloro-5-hydrazinylbenzoic acid;hydrochloride (CAS 184163-49-3) is a chemical compound with the molecular formula C7H8Cl2N2O2 and a molecular weight of 223.05 g/mol. IUPAC name: 2-chloro-5-hydrazinylbenzoic acid;hydrochloride. InChIKey: LYSZNCNDYFXUJI-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl2N2O2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 2-chloro-5-hydrazinylbenzoic acid;hydrochloride |
| InChIKey | LYSZNCNDYFXUJI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NN)C(=O)O)Cl.Cl |
Computed by PubChem (NCBI)