Products 35622-90-3
CAS 35622-90-3 is the registry number for 3,5-Dichloro-2,6-dimethoxypyridin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dichloro-2,6-dimethoxypyridin-4-amine (CAS 35622-90-3) is a chemical compound with the molecular formula C7H8Cl2N2O2 and a molecular weight of 223.05 g/mol. IUPAC name: 3,5-dichloro-2,6-dimethoxypyridin-4-amine. InChIKey: FKPZFQOIZOMQRJ-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl2N2O2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 3,5-dichloro-2,6-dimethoxypyridin-4-amine |
| InChIKey | FKPZFQOIZOMQRJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=N1)OC)Cl)N)Cl |
Computed by PubChem (NCBI)