CAS 67567-37-7 appears in our catalog under these names: 4-Chloro-2-nitrobenzylamine hydrochloride, 95%, 4-Chloro-2-nitrobenzylamine Hydrochloride. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 500mg, 1000mg.
(4-chloro-2-nitrophenyl)methanamine;hydrochloride (CAS 67567-37-7) is a chemical compound with the molecular formula C7H8Cl2N2O2 and a molecular weight of 223.05 g/mol. IUPAC name: (4-chloro-2-nitrophenyl)methanamine;hydrochloride. InChIKey: MLJCBOGDFBXAMU-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl2N2O2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | (4-chloro-2-nitrophenyl)methanamine;hydrochloride |
| InChIKey | MLJCBOGDFBXAMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)[N+](=O)[O-])CN.Cl |
Computed by PubChem (NCBI)