CAS 116599-39-4 appears in our catalog under these names: 4-Chloro-3-nitrobenzylamine hydrochloride, (4-Chloro-3-nitrobenzyl)amine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
(4-chloro-3-nitrophenyl)methanamine;hydrochloride (CAS 116599-39-4) is a chemical compound with the molecular formula C7H8Cl2N2O2 and a molecular weight of 223.05 g/mol. IUPAC name: (4-chloro-3-nitrophenyl)methanamine;hydrochloride. InChIKey: IPELJBOKRMZXRA-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl2N2O2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | (4-chloro-3-nitrophenyl)methanamine;hydrochloride |
| InChIKey | IPELJBOKRMZXRA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN)[N+](=O)[O-])Cl.Cl |
Computed by PubChem (NCBI)