CAS 41112-74-7 appears in our catalog under these names: 2-Chloro-4-hydrazinylbenzoic Acid Hydrochloride, 2-Chloro-4-hydrazinylbenzoic acid hydrochloride 95%, 2-Chloro-4-hydrazinylbenzoic acid hydrochloride, 95%, 95%, 2-Chloro-4-hydrazinylbenzoic acid hydrochloride, 96%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg.
2-chloro-4-hydrazinylbenzoic acid;hydrochloride (CAS 41112-74-7) is a chemical compound with the molecular formula C7H8Cl2N2O2 and a molecular weight of 223.05 g/mol. IUPAC name: 2-chloro-4-hydrazinylbenzoic acid;hydrochloride. InChIKey: CUMAWIRZIUSYGJ-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl2N2O2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 2-chloro-4-hydrazinylbenzoic acid;hydrochloride |
| InChIKey | CUMAWIRZIUSYGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NN)Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)