(2-Fluoro-3-(methoxycarbonyl)phenyl)boronic acid 98%
cas: 1315476-07-3 — see every product listed under this CAS number, including other names
(2-Fluoro-3-(methoxycarbonyl)phenyl)boronic acid 98% (CAS 1315476-07-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A506432-100mg |
| cas | 1315476-07-3 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 387.06 Pln | |
| Ambeed | 5g | 1221.44 Pln | |
| Ambeed | 10g | 2367.31 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A506432 |
(2-fluoro-3-methoxycarbonylphenyl)boronic acid (CAS 1315476-07-3) is a chemical compound with the molecular formula C8H8BFO4 and a molecular weight of 197.96 g/mol. IUPAC name: (2-fluoro-3-methoxycarbonylphenyl)boronic acid. InChIKey: ZWNQFICBQZRXEB-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO4 |
|---|---|
| Molecular weight | 197.96 g/mol |
| IUPAC name | (2-fluoro-3-methoxycarbonylphenyl)boronic acid |
| InChIKey | ZWNQFICBQZRXEB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-Fluoro-3-(methoxycarbonyl)phenyl)boronic acid, 2-Fluoro-3-(methoxycarbonyl)phenylboronic acid, 2-Fluoro-3-methoxycarbonylphenylboronic acid, (2-fluoro-3-methoxycarbonylphenyl)boronic acid, Benzoic acid, 3-borono-2-fluoro-, 1-methyl ester, [2-Fluoro 3-(Methoxycarbonyl)Phenyl]Boronic acid, (2-Fluoro-3-(methoxycarbonyl)phenyl)boronicacid, (2-Fluoro-3-methoxycarbonyl-phenyl)boronic acid