cas: 1315476-07-3 — see every product listed under this CAS number, including other names
(2-Fluoro-3-(methoxycarbonyl)phenyl)boronic acid, 98%, 98% (CAS 1315476-07-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111ZEI-100mg |
| cas | 1315476-07-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 318.80 Pln | |
| Chemat | 5g | 971.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-fluoro-3-methoxycarbonylphenyl)boronic acid (CAS 1315476-07-3) is a chemical compound with the molecular formula C8H8BFO4 and a molecular weight of 197.96 g/mol. IUPAC name: (2-fluoro-3-methoxycarbonylphenyl)boronic acid. InChIKey: ZWNQFICBQZRXEB-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO4 |
|---|---|
| Molecular weight | 197.96 g/mol |
| IUPAC name | (2-fluoro-3-methoxycarbonylphenyl)boronic acid |
| InChIKey | ZWNQFICBQZRXEB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)