(2-Fluoro-4,6-dimethoxyphenyl)boronic acid 97%
cas: 309977-93-3 — see every product listed under this CAS number, including other names
(2-Fluoro-4,6-dimethoxyphenyl)boronic acid 97% (CAS 309977-93-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A663636-100mg |
| cas | 309977-93-3 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 765.31 Pln | |
| Ambeed | 5g | 3546.56 Pln | |
| Ambeed | 10g | 4681.31 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A663636 |
(2-fluoro-4,6-dimethoxyphenyl)boronic acid (CAS 309977-93-3) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (2-fluoro-4,6-dimethoxyphenyl)boronic acid. InChIKey: VRYIYLGRLZLYPA-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (2-fluoro-4,6-dimethoxyphenyl)boronic acid |
| InChIKey | VRYIYLGRLZLYPA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)OC)OC)(O)O |
Computed by PubChem (NCBI)