cas: 1451391-98-2 — see every product listed under this CAS number, including other names
(2-Methoxy-3,5-dimethylphenyl)boronic acid, ≥99.5%, ≥99.5% (CAS 1451391-98-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12E75L-1g |
| cas | 1451391-98-2 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2910.80 Pln |
| purity | ≥99.5% |
|---|---|
| delivery time | 3 weeks |
(2-methoxy-3,5-dimethylphenyl)boronic acid (CAS 1451391-98-2) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (2-methoxy-3,5-dimethylphenyl)boronic acid. InChIKey: UHTQRLCDAMYQFY-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (2-methoxy-3,5-dimethylphenyl)boronic acid |
| InChIKey | UHTQRLCDAMYQFY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC)C)C)(O)O |
Computed by PubChem (NCBI)