cas: 1451391-98-2 — see every product listed under this CAS number, including other names
(2-Methoxy-3,5-dimethylphenyl)boronic acid, 98% (CAS 1451391-98-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A808457-10g |
| cas | 1451391-98-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 36630.16 Pln | |
| AmBeed | 25g | 71920.87 Pln | |
| AmBeed | 5g | 21566.02 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2-methoxy-3,5-dimethylphenyl)boronic acid (CAS 1451391-98-2) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (2-methoxy-3,5-dimethylphenyl)boronic acid. InChIKey: UHTQRLCDAMYQFY-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (2-methoxy-3,5-dimethylphenyl)boronic acid |
| InChIKey | UHTQRLCDAMYQFY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC)C)C)(O)O |
Computed by PubChem (NCBI)