cas: 279262-85-0 — see every product listed under this CAS number, including other names
(2-Methylbenzo[d]oxazol-5-yl)boronic acid, 98%, 98% (CAS 279262-85-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BG6K-100mg |
| cas | 279262-85-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 664.40 Pln | |
| Chemat | 1g | 1619.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-methyl-1,3-benzoxazol-5-yl)boronic acid (CAS 279262-85-0) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (2-methyl-1,3-benzoxazol-5-yl)boronic acid. InChIKey: YFPFSHFWNVZLJZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (2-methyl-1,3-benzoxazol-5-yl)boronic acid |
| InChIKey | YFPFSHFWNVZLJZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OC(=N2)C)(O)O |
Computed by PubChem (NCBI)