CAS 1214899-66-7 is the registry number for (1-Oxoisoindolin-4-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1-oxo-2,3-dihydroisoindol-4-yl)boronic acid (CAS 1214899-66-7) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (1-oxo-2,3-dihydroisoindol-4-yl)boronic acid. InChIKey: LDRHIAVTCMPJDH-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (1-oxo-2,3-dihydroisoindol-4-yl)boronic acid |
| InChIKey | LDRHIAVTCMPJDH-UHFFFAOYSA-N |
| SMILES | B(C1=C2CNC(=O)C2=CC=C1)(O)O |
Computed by PubChem (NCBI)