CAS 1217500-61-2 appears in our catalog under these names: (2–Oxoindolin–6–yl)boronic acid, (2-Oxoindolin-6-yl)boronic acid, 97%, (2-Oxoindolin-6-yl)boronic acid, 97%, 97%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
(2-oxo-1,3-dihydroindol-6-yl)boronic acid (CAS 1217500-61-2) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (2-oxo-1,3-dihydroindol-6-yl)boronic acid. InChIKey: YLNQBQVYRMHRAQ-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (2-oxo-1,3-dihydroindol-6-yl)boronic acid |
| InChIKey | YLNQBQVYRMHRAQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(CC(=O)N2)C=C1)(O)O |
Computed by PubChem (NCBI)