cas: 928063-81-4 — see every product listed under this CAS number, including other names
(2S,3R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methoxybutanoic acid, 98%, 98% (CAS 928063-81-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12C006-100mg |
| cas | 928063-81-4 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 357.20 Pln | |
| Chemat | 10g | 501.20 Pln | |
| Chemat | 25g | 938.00 Pln | |
| Chemat | 50g | 1701.20 Pln | |
| Chemat | 100g | 3102.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxybutanoic acid (CAS 928063-81-4) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxybutanoic acid. InChIKey: BOGQZFFOTLSMMA-XIKOKIGWSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxybutanoic acid |
| InChIKey | BOGQZFFOTLSMMA-XIKOKIGWSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC |
Computed by PubChem (NCBI)