CAS 1279032-75-5 is the registry number for N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-O-methyl-D-allothreonine, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg.
(2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxybutanoic acid (CAS 1279032-75-5) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxybutanoic acid. InChIKey: BOGQZFFOTLSMMA-KZULUSFZSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxybutanoic acid |
| InChIKey | BOGQZFFOTLSMMA-KZULUSFZSA-N |
| SMILES | C[C@H]([C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC |
Computed by PubChem (NCBI)