CAS 1279029-70-7 is the registry number for (2S,3S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methoxybutanoic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxybutanoic acid (CAS 1279029-70-7) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxybutanoic acid. InChIKey: BOGQZFFOTLSMMA-SGTLLEGYSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxybutanoic acid |
| InChIKey | BOGQZFFOTLSMMA-SGTLLEGYSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC |
Computed by PubChem (NCBI)