cas: 39070-63-8 — see every product listed under this CAS number, including other names
(3,4-Diaminophenyl)(phenyl)methanone (CAS 39070-63-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F242214-10G |
| cas | 39070-63-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 341.56 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 25g | 544.62 Pln |
| delivery time | 3-4 weeks |
|---|
(3,4-diaminophenyl)-phenylmethanone (CAS 39070-63-8) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: (3,4-diaminophenyl)-phenylmethanone. InChIKey: RXCOGDYOZQGGMK-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | (3,4-diaminophenyl)-phenylmethanone |
| InChIKey | RXCOGDYOZQGGMK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)N)N |
Computed by PubChem (NCBI)