cas: 39070-63-8 — see every product listed under this CAS number, including other names
3,4-Diaminobenzophenone, 95%, 95% (CAS 39070-63-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BQB-10g |
| cas | 39070-63-8 |
| size | 10g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 222.80 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 25g | 347.60 Pln | |
| Chemat | 100g | 990.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3,4-diaminophenyl)-phenylmethanone (CAS 39070-63-8) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: (3,4-diaminophenyl)-phenylmethanone. InChIKey: RXCOGDYOZQGGMK-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | (3,4-diaminophenyl)-phenylmethanone |
| InChIKey | RXCOGDYOZQGGMK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)N)N |
Computed by PubChem (NCBI)