cas: 737000-76-9 — see every product listed under this CAS number, including other names
(3,5-Difluoro-2-methoxyphenyl)boronic acid, 97% (CAS 737000-76-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 365820010 |
| cas | 737000-76-9 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 196.00 Pln | |
| Thermo Scientific (Acros) | 5g | 659.26 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 653.95 Pln | |
| Fluorochem | 10g | 1122.54 Pln | |
| Fluorochem | 25g | 2200.28 Pln | |
| Fluorochem | 100g | 6875.72 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
(3,5-difluoro-2-methoxyphenyl)boronic acid (CAS 737000-76-9) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (3,5-difluoro-2-methoxyphenyl)boronic acid. InChIKey: JXQHRWOUVJRCSR-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (3,5-difluoro-2-methoxyphenyl)boronic acid |
| InChIKey | JXQHRWOUVJRCSR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC)F)F)(O)O |
Computed by PubChem (NCBI)