cas: 1334307-13-9 — see every product listed under this CAS number, including other names
(3-((3-(TRIFLUOROMETHYL)BENZYL)OXY)PHENYL)BORONIC ACID, 97% (CAS 1334307-13-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F824538-5G |
| cas | 1334307-13-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 9713.26 Pln | |
| Fluorochem | 100mg | 690.40 Pln | |
| Fluorochem | 250mg | 1091.30 Pln | |
| Fluorochem | 1g | 2231.52 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]boronic acid (CAS 1334307-13-9) is a chemical compound with the molecular formula C14H12BF3O3 and a molecular weight of 296.05 g/mol. IUPAC name: [3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]boronic acid. InChIKey: GFWAXSZKGMQBDW-UHFFFAOYSA-N.
| Molecular formula | C14H12BF3O3 |
|---|---|
| Molecular weight | 296.05 g/mol |
| IUPAC name | [3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]boronic acid |
| InChIKey | GFWAXSZKGMQBDW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC2=CC(=CC=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)