CAS 1451393-42-2 appears in our catalog under these names: 3-Benzyloxy-5-trifluoromethylphenylboronic acid, 95%, (3-(Benzyloxy)-5-(trifluoromethyl)phenyl)boronic acid, 97%, 3-Benzyloxy-5-trifluoromethylphenylboronic acid, 97%, 97%, (3-(Benzyloxy)-5-(trifluoromethyl)phenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
[3-phenylmethoxy-5-(trifluoromethyl)phenyl]boronic acid (CAS 1451393-42-2) is a chemical compound with the molecular formula C14H12BF3O3 and a molecular weight of 296.05 g/mol. IUPAC name: [3-phenylmethoxy-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: MHUAAZABXBWEPZ-UHFFFAOYSA-N.
| Molecular formula | C14H12BF3O3 |
|---|---|
| Molecular weight | 296.05 g/mol |
| IUPAC name | [3-phenylmethoxy-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | MHUAAZABXBWEPZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OCC2=CC=CC=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)