CAS 1333084-03-9 appears in our catalog under these names: (2-([4-(Trifluoromethyl)phenyl]methoxy)phenyl)boronic acid, 95%, (2-((4-(Trifluoromethyl)benzyl)oxy)phenyl)boronic acid, 98%, 2–(4–Trifluoromethylbenzyloxy) phenylboronic acid, (2-((4-(Trifluoromethyl)benzyl)oxy)phenyl)boronic acid, 95%, 95%, Boronic acid, B-[2-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
[2-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]boronic acid (CAS 1333084-03-9) is a chemical compound with the molecular formula C14H12BF3O3 and a molecular weight of 296.05 g/mol. IUPAC name: [2-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]boronic acid. InChIKey: JMJOAUMIIUYJOC-UHFFFAOYSA-N.
| Molecular formula | C14H12BF3O3 |
|---|---|
| Molecular weight | 296.05 g/mol |
| IUPAC name | [2-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]boronic acid |
| InChIKey | JMJOAUMIIUYJOC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1OCC2=CC=C(C=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)