CAS 1701435-39-3 appears in our catalog under these names: 2-Benzyloxy-4-(trifluoromethyl)phenylboronic acid 98%, 2-Benzyloxy-4-(trifluoromethyl)phenylboronic acid, 98%, 98%, (2-(Benzyloxy)-4-(trifluoromethyl)phenyl)boronic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
[2-phenylmethoxy-4-(trifluoromethyl)phenyl]boronic acid (CAS 1701435-39-3) is a chemical compound with the molecular formula C14H12BF3O3 and a molecular weight of 296.05 g/mol. IUPAC name: [2-phenylmethoxy-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: NMBJNPIUYMLHPK-UHFFFAOYSA-N.
| Molecular formula | C14H12BF3O3 |
|---|---|
| Molecular weight | 296.05 g/mol |
| IUPAC name | [2-phenylmethoxy-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | NMBJNPIUYMLHPK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(F)(F)F)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)