(3-(Difluoromethoxy)phenyl)boronic acid, 97%
cas: 866607-09-2 — see every product listed under this CAS number, including other names
(3-(Difluoromethoxy)phenyl)boronic acid, 97% (CAS 866607-09-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A634457-250mg |
| cas | 866607-09-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 1060.12 Pln | |
| Chemat | 50mg | 78.80 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 198.80 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 336.57 Pln | |
| BLDpharm | 5g | 1136.29 Pln | |
| Fluorochem | 100mg | 102.06 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 1054.85 Pln | |
| Fluorochem | 10g | 1919.13 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[3-(difluoromethoxy)phenyl]boronic acid (CAS 866607-09-2) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: [3-(difluoromethoxy)phenyl]boronic acid. InChIKey: FGQKXEUNYFZVMW-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | [3-(difluoromethoxy)phenyl]boronic acid |
| InChIKey | FGQKXEUNYFZVMW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OC(F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(Difluoromethoxy)benzeneboronic acid, (3-(Difluoromethoxy)phenyl)boronic acid, 3-(Difluoromethoxy)phenylboronic acid, [3-(difluoromethoxy)phenyl]boronic acid, 1-Borono-3-(difluoromethoxy)benzene, Boronic acid, [3-(difluoromethoxy)phenyl]-, 3-difluoromethoxybenzeneboronic acid, 3-difluoromethoxybenzene-boronic acid, (3-(Difluoromethoxy)phenyl)boronicacid, (3-(Difluoromethoxy)phenyl)boronic acid(contains varying amounts of anhydride)