cas: 5267-37-8 — see every product listed under this CAS number, including other names
(3-Chlorophenyl)(phenyl)methanamine hydrochloride 98% (CAS 5267-37-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A595357-100mg |
| cas | 5267-37-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 3057.06 Pln | |
| Ambeed | 25g | 14994.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A595357 |
(3-chlorophenyl)-phenylmethanamine;hydrochloride (CAS 5267-37-8) is a chemical compound with the molecular formula C13H13Cl2N and a molecular weight of 254.15 g/mol. IUPAC name: (3-chlorophenyl)-phenylmethanamine;hydrochloride. InChIKey: UCOACANPNQMECK-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2N |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | (3-chlorophenyl)-phenylmethanamine;hydrochloride |
| InChIKey | UCOACANPNQMECK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=CC=C2)Cl)N.Cl |
Computed by PubChem (NCBI)