cas: 5267-37-8 — see every product listed under this CAS number, including other names
(3-Chlorophenyl)(phenyl)methanamine hydrochloride, 98%, 98% (CAS 5267-37-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 25g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DLJA-100mg |
| cas | 5267-37-8 |
| size | 100mg |
| availability | 325g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 530.00 Pln | |
| Chemat | 25g | 11733.20 Pln | |
| Chemat | 5g | 2392.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3-chlorophenyl)-phenylmethanamine;hydrochloride (CAS 5267-37-8) is a chemical compound with the molecular formula C13H13Cl2N and a molecular weight of 254.15 g/mol. IUPAC name: (3-chlorophenyl)-phenylmethanamine;hydrochloride. InChIKey: UCOACANPNQMECK-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2N |
|---|---|
| Molecular weight | 254.15 g/mol |
| IUPAC name | (3-chlorophenyl)-phenylmethanamine;hydrochloride |
| InChIKey | UCOACANPNQMECK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=CC=C2)Cl)N.Cl |
Computed by PubChem (NCBI)